C11H19N3O2 — CID 65334460
N-(2-methylpropyl)-3-(oxan-4-yl)-1,2,4-oxadiazol-5-amine (PubChem CID 65334460) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(2-methylpropyl)-3-(oxan-4-yl)-1,2,4-oxadiazol-5-amine.
| Compound Name | N-(2-methylpropyl)-3-(oxan-4-yl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 65334460 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-(2-methylpropyl)-3-(oxan-4-yl)-1,2,4-oxadiazol-5-amine |
| SMILES | CC(C)CNc1nc(C2CCOCC2)no1 |
| InChI | InChI=1S/C11H19N3O2/c1-8(2)7-12-11-13-10(14-16-11)9-3-5-15-6-4-9/h8-9H,3-7H2,1-2H3,(H,12,13,14) |
| InChIKey | YBQCKOGAXHRFFC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |