About 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid
3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid (PubChem CID 83831304) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid.
Analyze 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid?
The IUPAC name of 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid (CID 83831304) is 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid.
What is the SMILES notation for 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid?
The canonical SMILES for 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid is O=C(O)CCNc1nc(C2CC2)no1.
What is the InChIKey of 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid?
The InChIKey is UQBPJNCTUGYLOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c12-6(13)3-4-9-8-10-7(11-14-8)5-1-2-5/h5H,1-4H2,(H,12,13)(H,9,10,11).
What are the key properties of 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid?
3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid has a molecular weight of 197.19 g/mol, XLogP of 0.83, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)amino]propanoic acid is sourced from PubChem (CID 83831304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).