C14H25N3O — CID 80601727
2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)butan-2-amine (PubChem CID 80601727) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)butan-2-amine.
| Compound Name | 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)butan-2-amine |
|---|---|
| PubChem CID | 80601727 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)butan-2-amine |
| SMILES | CCC(C)(N)c1nc(C2CCCCCCC2)no1 |
| InChI | InChI=1S/C14H25N3O/c1-3-14(2,15)13-16-12(17-18-13)11-9-7-5-4-6-8-10-11/h11H,3-10,15H2,1-2H3 |
| InChIKey | WPJDELUTLCTREQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |