C9H12N2O3 — CID 115080133
3-(oxan-3-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde (PubChem CID 115080133) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-(oxan-3-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde.
| Compound Name | 3-(oxan-3-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 115080133 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 3-(oxan-3-ylmethyl)-1,2,4-oxadiazole-5-carbaldehyde |
| SMILES | O=Cc1nc(CC2CCCOC2)no1 |
| InChI | InChI=1S/C9H12N2O3/c12-5-9-10-8(11-14-9)4-7-2-1-3-13-6-7/h5,7H,1-4,6H2 |
| InChIKey | BWVPSUOQSUNLMX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|