C13H21N3O2 — CID 115080678
3-(oxan-3-ylmethyl)-5-piperidin-4-yl-1,2,4-oxadiazole (PubChem CID 115080678) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-(oxan-3-ylmethyl)-5-piperidin-4-yl-1,2,4-oxadiazole.
| Compound Name | 3-(oxan-3-ylmethyl)-5-piperidin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 115080678 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 3-(oxan-3-ylmethyl)-5-piperidin-4-yl-1,2,4-oxadiazole |
| SMILES | C1COCC(Cc2noc(C3CCNCC3)n2)C1 |
| InChI | InChI=1S/C13H21N3O2/c1-2-10(9-17-7-1)8-12-15-13(18-16-12)11-3-5-14-6-4-11/h10-11,14H,1-9H2 |
| InChIKey | KQLCJVAYLUMGEI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |