C11H12ClN3O2 — CID 115080752
3-(5-chlorofuran-2-yl)-5-piperidin-3-yl-1,2,4-oxadiazole (PubChem CID 115080752) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is 3-(5-chlorofuran-2-yl)-5-piperidin-3-yl-1,2,4-oxadiazole.
| Compound Name | 3-(5-chlorofuran-2-yl)-5-piperidin-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 115080752 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 3-(5-chlorofuran-2-yl)-5-piperidin-3-yl-1,2,4-oxadiazole |
| SMILES | Clc1ccc(-c2noc(C3CCCNC3)n2)o1 |
| InChI | InChI=1S/C11H12ClN3O2/c12-9-4-3-8(16-9)10-14-11(17-15-10)7-2-1-5-13-6-7/h3-4,7,13H,1-2,5-6H2 |
| InChIKey | JWLLRSCZPAXQGX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |