C10H13NO3 — CID 115083047
1-[2-(oxolan-2-ylmethyl)-1,3-oxazol-4-yl]ethanone (PubChem CID 115083047) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-[2-(oxolan-2-ylmethyl)-1,3-oxazol-4-yl]ethanone.
| Compound Name | 1-[2-(oxolan-2-ylmethyl)-1,3-oxazol-4-yl]ethanone |
|---|---|
| PubChem CID | 115083047 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1-[2-(oxolan-2-ylmethyl)-1,3-oxazol-4-yl]ethanone |
| SMILES | CC(=O)c1coc(CC2CCCO2)n1 |
| InChI | InChI=1S/C10H13NO3/c1-7(12)9-6-14-10(11-9)5-8-3-2-4-13-8/h6,8H,2-5H2,1H3 |
| InChIKey | LWWMZLIMOXEGBG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |