C10H8N2O2 — CID 115083676
2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde (PubChem CID 115083676) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde.
| Compound Name | 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde |
|---|---|
| PubChem CID | 115083676 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde |
| SMILES | O=CCc1coc(-c2ccccn2)n1 |
| InChI | InChI=1S/C10H8N2O2/c13-6-4-8-7-14-10(12-8)9-3-1-2-5-11-9/h1-3,5-7H,4H2 |
| InChIKey | GKBOUNHBKOUPIF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|