About 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde
2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde (PubChem CID 115083676) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde |
| PubChem CID | 115083676 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde |
| SMILES | O=CCc1coc(-c2ccccn2)n1 |
| InChI | InChI=1S/C10H8N2O2/c13-6-4-8-7-14-10(12-8)9-3-1-2-5-11-9/h1-3,5-7H,4H2 |
| InChIKey | GKBOUNHBKOUPIF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde?
The IUPAC name of 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde (CID 115083676) is 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde.
What is the SMILES notation for 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde?
The canonical SMILES for 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde is O=CCc1coc(-c2ccccn2)n1.
What is the InChIKey of 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde?
The InChIKey is GKBOUNHBKOUPIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c13-6-4-8-7-14-10(12-8)9-3-1-2-5-11-9/h1-3,5-7H,4H2.
What are the key properties of 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde?
2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde has a molecular weight of 188.19 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-pyridin-2-yl-1,3-oxazol-4-yl)acetaldehyde is sourced from PubChem (CID 115083676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).