C12H13FN2O — CID 115087279
1-[2-(2-fluorophenyl)-1,3-oxazol-5-yl]propan-2-amine (PubChem CID 115087279) has the molecular formula C12H13FN2O and a molecular weight of 220.25 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-1,3-oxazol-5-yl]propan-2-amine.
| Compound Name | 1-[2-(2-fluorophenyl)-1,3-oxazol-5-yl]propan-2-amine |
|---|---|
| PubChem CID | 115087279 |
| Molecular Formula | C12H13FN2O |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-1,3-oxazol-5-yl]propan-2-amine |
| SMILES | CC(N)Cc1cnc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C12H13FN2O/c1-8(14)6-9-7-15-12(16-9)10-4-2-3-5-11(10)13/h2-5,7-8H,6,14H2,1H3 |
| InChIKey | GWNRKACTMACLAQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |