C15H17N3OS — CID 11508767
N-[(3R)-1-azabicyclo[2.2.2]oct-3-yl]thieno[2,3-c]pyridine-5-carboxamide (PubChem CID 11508767) has the molecular formula C15H17N3OS and a molecular weight of 287.40 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]thieno[2,3-c]pyridine-5-carboxamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]oct-3-yl]thieno[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 11508767 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]thieno[2,3-c]pyridine-5-carboxamide |
| SMILES | C1CN2CCC1[C@H](C2)NC(=O)C3=NC=C4C(=C3)C=CS4 |
| InChI | InChI=1S/C15H17N3OS/c19-15(12-7-11-3-6-20-14(11)8-16-12)17-13-9-18-4-1-10(13)2-5-18/h3,6-8,10,13H,1-2,4-5,9H2,(H,17,19)/t13-/m0/s1 |
| InChIKey | NJNIZJCRCANYGV-ZDUSSCGKSA-N |
| XLogP | 2.10 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | 383 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |