C10H15NOS2 — CID 115088747
[2-(thian-2-ylmethyl)-1,3-thiazol-4-yl]methanol (PubChem CID 115088747) has the molecular formula C10H15NOS2 and a molecular weight of 229.37 g/mol. Its IUPAC name is [2-(thian-2-ylmethyl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-(thian-2-ylmethyl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 115088747 |
| Molecular Formula | C10H15NOS2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | [2-(thian-2-ylmethyl)-1,3-thiazol-4-yl]methanol |
| SMILES | OCc1csc(CC2CCCCS2)n1 |
| InChI | InChI=1S/C10H15NOS2/c12-6-8-7-14-10(11-8)5-9-3-1-2-4-13-9/h7,9,12H,1-6H2 |
| InChIKey | QKRXRIPZUJSDQJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |