C17H22NO+ — CID 11509227
4-(1-butylpyridin-1-ium-4-yl)-3,5-dimethylphenol (PubChem CID 11509227) has the molecular formula C17H22NO+ and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-(1-butylpyridin-1-ium-4-yl)-3,5-dimethylphenol.
| Compound Name | 4-(1-butylpyridin-1-ium-4-yl)-3,5-dimethylphenol |
|---|---|
| PubChem CID | 11509227 |
| Molecular Formula | C17H22NO+ |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4-(1-butylpyridin-1-ium-4-yl)-3,5-dimethylphenol |
| SMILES | CCCC[n+]1ccc(-c2c(C)cc(O)cc2C)cc1 |
| InChI | InChI=1S/C17H21NO/c1-4-5-8-18-9-6-15(7-10-18)17-13(2)11-16(19)12-14(17)3/h6-7,9-12H,4-5,8H2,1-3H3/p+1 |
| InChIKey | HPJAUTMMEJUDSK-UHFFFAOYSA-O |
| XLogP | 3.76 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|