C9H16O3S — CID 115094429
[2-(thian-4-yl)-1,3-dioxolan-4-yl]methanol (PubChem CID 115094429) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is [2-(thian-4-yl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2-(thian-4-yl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 115094429 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | [2-(thian-4-yl)-1,3-dioxolan-4-yl]methanol |
| SMILES | OCC1COC(C2CCSCC2)O1 |
| InChI | InChI=1S/C9H16O3S/c10-5-8-6-11-9(12-8)7-1-3-13-4-2-7/h7-10H,1-6H2 |
| InChIKey | SKSVGILBFIDZLD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |