C9H14O4S — CID 115094440
2-(thian-4-yl)-1,3-dioxolane-4-carboxylic acid (PubChem CID 115094440) has the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. Its IUPAC name is 2-(thian-4-yl)-1,3-dioxolane-4-carboxylic acid.
| Compound Name | 2-(thian-4-yl)-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 115094440 |
| Molecular Formula | C9H14O4S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-(thian-4-yl)-1,3-dioxolane-4-carboxylic acid |
| SMILES | O=C(O)C1COC(C2CCSCC2)O1 |
| InChI | InChI=1S/C9H14O4S/c10-8(11)7-5-12-9(13-7)6-1-3-14-4-2-6/h6-7,9H,1-5H2,(H,10,11) |
| InChIKey | HTYMQLIKGKFTJW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |