C9H14O6S — CID 115094501
2-(1,1-dioxothian-3-yl)-1,3-dioxolane-4-carboxylic acid (PubChem CID 115094501) has the molecular formula C9H14O6S and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-(1,1-dioxothian-3-yl)-1,3-dioxolane-4-carboxylic acid.
| Compound Name | 2-(1,1-dioxothian-3-yl)-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 115094501 |
| Molecular Formula | C9H14O6S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-(1,1-dioxothian-3-yl)-1,3-dioxolane-4-carboxylic acid |
| SMILES | O=C(O)C1COC(C2CCCS(=O)(=O)C2)O1 |
| InChI | InChI=1S/C9H14O6S/c10-8(11)7-4-14-9(15-7)6-2-1-3-16(12,13)5-6/h6-7,9H,1-5H2,(H,10,11) |
| InChIKey | OEPCWQCVBLPBQZ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |