2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid

C9H14O6S — CID 115094563

IUPAC2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid
SMILESO=C(O)C1COC(CC2CCCS2(=O)=O)O1
InChIInChI=1S/C9H14O6S/c10-9(11)7-5-14-8(15-7)4-6-2-1-3-16(6,12)13/h6-8H,1-5H2,(H,10,11)
InChIKeyAAFCDQPUGXZMCI-UHFFFAOYSA-N
MW250.27 g/mol
LogP-0.22
Rot. Bonds3

About 2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid

2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid (PubChem CID 115094563) has the molecular formula C9H14O6S and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid.

Molecular Properties

Compound Name2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid
PubChem CID115094563
Molecular FormulaC9H14O6S
Molecular Weight250.27 g/mol
Exact Mass250.05
IUPAC Name2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid
SMILESO=C(O)C1COC(CC2CCCS2(=O)=O)O1
InChIInChI=1S/C9H14O6S/c10-9(11)7-5-14-8(15-7)4-6-2-1-3-16(6,12)13/h6-8H,1-5H2,(H,10,11)
InChIKeyAAFCDQPUGXZMCI-UHFFFAOYSA-N
XLogP-0.22
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.27
LogP ≤ 5-0.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of 2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid (CID 115094563) is 2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for 2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for 2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid is O=C(O)C1COC(CC2CCCS2(=O)=O)O1.
What is the InChIKey of 2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid?
The InChIKey is AAFCDQPUGXZMCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O6S/c10-9(11)7-5-14-8(15-7)4-6-2-1-3-16(6,12)13/h6-8H,1-5H2,(H,10,11).
What are the key properties of 2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid?
2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid has a molecular weight of 250.27 g/mol, XLogP of -0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothiolan-2-yl)methyl]-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 115094563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).