About 2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid
2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid (PubChem CID 115094521) has the molecular formula C8H12O6S
and a molecular weight of 236.24 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid.
Analyze 2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of 2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid (CID 115094521) is 2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for 2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for 2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid is O=C(O)C1COC(C2CCCS2(=O)=O)O1.
What is the InChIKey of 2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid?
The InChIKey is DJTBFTCESKKZTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O6S/c9-7(10)5-4-13-8(14-5)6-2-1-3-15(6,11)12/h5-6,8H,1-4H2,(H,9,10).
What are the key properties of 2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid?
2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid has a molecular weight of 236.24 g/mol, XLogP of -0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-2-yl)-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 115094521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).