About 2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid
2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid (PubChem CID 115094564) has the molecular formula C9H14O4S
and a molecular weight of 218.27 g/mol. Its IUPAC name is 2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid.
Analyze 2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of 2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid (CID 115094564) is 2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for 2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for 2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid is O=C(O)C1COC(CC2CCCS2)O1.
What is the InChIKey of 2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid?
The InChIKey is UJVPXQHCZKKRPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4S/c10-9(11)7-5-12-8(13-7)4-6-2-1-3-14-6/h6-8H,1-5H2,(H,10,11).
What are the key properties of 2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid?
2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid has a molecular weight of 218.27 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thiolan-2-ylmethyl)-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 115094564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).