About 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one
5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one (PubChem CID 115097278) has the molecular formula C13H15BrN2O
and a molecular weight of 295.18 g/mol. Its IUPAC name is 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one.
Molecular Properties
| Compound Name | 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one |
| PubChem CID | 115097278 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one |
| SMILES | CCN1c2c(Br)cccc2NC(=O)C12CCC2 |
| InChI | InChI=1S/C13H15BrN2O/c1-2-16-11-9(14)5-3-6-10(11)15-12(17)13(16)7-4-8-13/h3,5-6H,2,4,7-8H2,1H3,(H,15,17) |
| InChIKey | PGZFYGSJARRGKP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one?
The IUPAC name of 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one (CID 115097278) is 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one.
What is the SMILES notation for 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one?
The canonical SMILES for 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one is CCN1c2c(Br)cccc2NC(=O)C12CCC2.
What is the InChIKey of 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one?
The InChIKey is PGZFYGSJARRGKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN2O/c1-2-16-11-9(14)5-3-6-10(11)15-12(17)13(16)7-4-8-13/h3,5-6H,2,4,7-8H2,1H3,(H,15,17).
What are the key properties of 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one?
5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one has a molecular weight of 295.18 g/mol, XLogP of 3.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-ethylspiro[1H-quinoxaline-3,1'-cyclobutane]-2-one is sourced from PubChem (CID 115097278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).