C15H20N2O2 — CID 115098187
4-ethyl-6-hydroxyspiro[1H-quinoxaline-3,1'-cyclohexane]-2-one (PubChem CID 115098187) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-ethyl-6-hydroxyspiro[1H-quinoxaline-3,1'-cyclohexane]-2-one.
| Compound Name | 4-ethyl-6-hydroxyspiro[1H-quinoxaline-3,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 115098187 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 4-ethyl-6-hydroxyspiro[1H-quinoxaline-3,1'-cyclohexane]-2-one |
| SMILES | CCN1c2cc(O)ccc2NC(=O)C12CCCCC2 |
| InChI | InChI=1S/C15H20N2O2/c1-2-17-13-10-11(18)6-7-12(13)16-14(19)15(17)8-4-3-5-9-15/h6-7,10,18H,2-5,8-9H2,1H3,(H,16,19) |
| InChIKey | WSFQRPKHEMVFMI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|