About 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol
4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol (PubChem CID 115095246) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol.
Molecular Properties
| Compound Name | 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol |
| PubChem CID | 115095246 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol |
| SMILES | CCN1CC(C)(C)Nc2ccc(O)cc21 |
| InChI | InChI=1S/C12H18N2O/c1-4-14-8-12(2,3)13-10-6-5-9(15)7-11(10)14/h5-7,13,15H,4,8H2,1-3H3 |
| InChIKey | CMBWXDLQHQAFIL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol?
The IUPAC name of 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol (CID 115095246) is 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol.
What is the SMILES notation for 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol?
The canonical SMILES for 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol is CCN1CC(C)(C)Nc2ccc(O)cc21.
What is the InChIKey of 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol?
The InChIKey is CMBWXDLQHQAFIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-4-14-8-12(2,3)13-10-6-5-9(15)7-11(10)14/h5-7,13,15H,4,8H2,1-3H3.
What are the key properties of 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol?
4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol has a molecular weight of 206.29 g/mol, XLogP of 2.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,2-dimethyl-1,3-dihydroquinoxalin-6-ol is sourced from PubChem (CID 115095246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).