C16H21ClN2O — CID 115098186
6-chloro-4-propan-2-ylspiro[1H-quinoxaline-3,1'-cyclohexane]-2-one (PubChem CID 115098186) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 6-chloro-4-propan-2-ylspiro[1H-quinoxaline-3,1'-cyclohexane]-2-one.
| Compound Name | 6-chloro-4-propan-2-ylspiro[1H-quinoxaline-3,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 115098186 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 6-chloro-4-propan-2-ylspiro[1H-quinoxaline-3,1'-cyclohexane]-2-one |
| SMILES | CC(C)N1c2cc(Cl)ccc2NC(=O)C12CCCCC2 |
| InChI | InChI=1S/C16H21ClN2O/c1-11(2)19-14-10-12(17)6-7-13(14)18-15(20)16(19)8-4-3-5-9-16/h6-7,10-11H,3-5,8-9H2,1-2H3,(H,18,20) |
| InChIKey | BANRWJXGMWPPQR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |