C25H23FN4O — CID 11509879
1-[4-[1-[3-(aminomethyl)phenyl]-7-fluoro-3-methylindazol-6-yl]phenyl]pyrrolidin-2-one (PubChem CID 11509879) has the molecular formula C25H23FN4O and a molecular weight of 414.48 g/mol. Its IUPAC name is 1-[4-[1-[3-(aminomethyl)phenyl]-7-fluoro-3-methylindazol-6-yl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[1-[3-(aminomethyl)phenyl]-7-fluoro-3-methylindazol-6-yl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11509879 |
| Molecular Formula | C25H23FN4O |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-[4-[1-[3-(aminomethyl)phenyl]-7-fluoro-3-methylindazol-6-yl]phenyl]pyrrolidin-2-one |
| SMILES | Cc1nn(-c2cccc(CN)c2)c2c(F)c(-c3ccc(N4CCCC4=O)cc3)ccc12 |
| InChI | InChI=1S/C25H23FN4O/c1-16-21-11-12-22(18-7-9-19(10-8-18)29-13-3-6-23(29)31)24(26)25(21)30(28-16)20-5-2-4-17(14-20)15-27/h2,4-5,7-12,14H,3,6,13,15,27H2,1H3 |
| InChIKey | JGKHUDVYQPUWSH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |