C11H15ClN2O — CID 68967881
1-[3-(aminomethyl)phenyl]pyrrolidin-2-one;hydrochloride (PubChem CID 68967881) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]pyrrolidin-2-one;hydrochloride.
| Compound Name | 1-[3-(aminomethyl)phenyl]pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 68967881 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]pyrrolidin-2-one;hydrochloride |
| SMILES | Cl.NCc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C11H14N2O.ClH/c12-8-9-3-1-4-10(7-9)13-6-2-5-11(13)14;/h1,3-4,7H,2,5-6,8,12H2;1H |
| InChIKey | PZTMPHAGWUWPIF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |