About 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one
6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one (PubChem CID 115100401) has the molecular formula C13H26N4O
and a molecular weight of 254.38 g/mol. Its IUPAC name is 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one |
| PubChem CID | 115100401 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one |
| SMILES | CC1CNCCN(CCN2CCN(C)CC2)C1=O |
| InChI | InChI=1S/C13H26N4O/c1-12-11-14-3-4-17(13(12)18)10-9-16-7-5-15(2)6-8-16/h12,14H,3-11H2,1-2H3 |
| InChIKey | CWANBFDVDCKATL-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one?
The IUPAC name of 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one (CID 115100401) is 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one.
What is the SMILES notation for 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one?
The canonical SMILES for 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one is CC1CNCCN(CCN2CCN(C)CC2)C1=O.
What is the InChIKey of 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one?
The InChIKey is CWANBFDVDCKATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4O/c1-12-11-14-3-4-17(13(12)18)10-9-16-7-5-15(2)6-8-16/h12,14H,3-11H2,1-2H3.
What are the key properties of 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one?
6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one has a molecular weight of 254.38 g/mol, XLogP of -0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-[2-(4-methylpiperazin-1-yl)ethyl]-1,4-diazepan-5-one is sourced from PubChem (CID 115100401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).