C12H16N2O2 — CID 115100485
4-[(3-hydroxyphenyl)methyl]-1,4-diazepan-5-one (PubChem CID 115100485) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 4-[(3-hydroxyphenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | 4-[(3-hydroxyphenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 115100485 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 4-[(3-hydroxyphenyl)methyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCNCCN1Cc1cccc(O)c1 |
| InChI | InChI=1S/C12H16N2O2/c15-11-3-1-2-10(8-11)9-14-7-6-13-5-4-12(14)16/h1-3,8,13,15H,4-7,9H2 |
| InChIKey | RMQOIYLTKQIDKB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |