C11H16N2O3S — CID 115101053
3-[(1,1-dioxo-1,2,5-thiadiazepan-2-yl)methyl]phenol (PubChem CID 115101053) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2,5-thiadiazepan-2-yl)methyl]phenol.
| Compound Name | 3-[(1,1-dioxo-1,2,5-thiadiazepan-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 115101053 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-[(1,1-dioxo-1,2,5-thiadiazepan-2-yl)methyl]phenol |
| SMILES | O=S1(=O)CCNCCN1Cc1cccc(O)c1 |
| InChI | InChI=1S/C11H16N2O3S/c14-11-3-1-2-10(8-11)9-13-6-4-12-5-7-17(13,15)16/h1-3,8,12,14H,4-7,9H2 |
| InChIKey | CVJQRXCGCZIJRR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |