C16H20ClN3O — CID 120910881
3-[(2-pyridin-4-ylpiperazin-1-yl)methyl]phenol;hydrochloride (PubChem CID 120910881) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 3-[(2-pyridin-4-ylpiperazin-1-yl)methyl]phenol;hydrochloride.
| Compound Name | 3-[(2-pyridin-4-ylpiperazin-1-yl)methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 120910881 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-[(2-pyridin-4-ylpiperazin-1-yl)methyl]phenol;hydrochloride |
| SMILES | Cl.Oc1cccc(CN2CCNCC2c2ccncc2)c1 |
| InChI | InChI=1S/C16H19N3O.ClH/c20-15-3-1-2-13(10-15)12-19-9-8-18-11-16(19)14-4-6-17-7-5-14;/h1-7,10,16,18,20H,8-9,11-12H2;1H |
| InChIKey | FVCSCTBCBUISLR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |