C21H28ClN3O — CID 120910845
1-[(3-cyclopentyloxyphenyl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride (PubChem CID 120910845) has the molecular formula C21H28ClN3O and a molecular weight of 373.93 g/mol. Its IUPAC name is 1-[(3-cyclopentyloxyphenyl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride.
| Compound Name | 1-[(3-cyclopentyloxyphenyl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120910845 |
| Molecular Formula | C21H28ClN3O |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-[(3-cyclopentyloxyphenyl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride |
| SMILES | Cl.c1cc(CN2CCNCC2c2ccncc2)cc(OC2CCCC2)c1 |
| InChI | InChI=1S/C21H27N3O.ClH/c1-2-6-19(5-1)25-20-7-3-4-17(14-20)16-24-13-12-23-15-21(24)18-8-10-22-11-9-18;/h3-4,7-11,14,19,21,23H,1-2,5-6,12-13,15-16H2;1H |
| InChIKey | DTZJBSDPFGZRJQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |