C15H19NO3S — CID 116816644
4-[3-[(1,1-dioxothiazinan-2-yl)methyl]phenyl]but-3-yn-1-ol (PubChem CID 116816644) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 4-[3-[(1,1-dioxothiazinan-2-yl)methyl]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-[(1,1-dioxothiazinan-2-yl)methyl]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 116816644 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 4-[3-[(1,1-dioxothiazinan-2-yl)methyl]phenyl]but-3-yn-1-ol |
| SMILES | O=S1(=O)CCCCN1Cc1cccc(C#CCCO)c1 |
| InChI | InChI=1S/C15H19NO3S/c17-10-3-1-6-14-7-5-8-15(12-14)13-16-9-2-4-11-20(16,18)19/h5,7-8,12,17H,2-4,9-11,13H2 |
| InChIKey | GANJOQLDQQAMNP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|