C14H15NO2 — CID 55031427
1-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]pyrrolidin-2-one (PubChem CID 55031427) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 55031427 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1Cc1cccc(C#CCO)c1 |
| InChI | InChI=1S/C14H15NO2/c16-9-3-6-12-4-1-5-13(10-12)11-15-8-2-7-14(15)17/h1,4-5,10,16H,2,7-9,11H2 |
| InChIKey | WRINXTZZFMJULC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|