C10H21N3O2S — CID 115100972
2-(1-ethylpyrrolidin-3-yl)-1,2,5-thiadiazepane 1,1-dioxide (PubChem CID 115100972) has the molecular formula C10H21N3O2S and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-(1-ethylpyrrolidin-3-yl)-1,2,5-thiadiazepane 1,1-dioxide.
| Compound Name | 2-(1-ethylpyrrolidin-3-yl)-1,2,5-thiadiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 115100972 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-(1-ethylpyrrolidin-3-yl)-1,2,5-thiadiazepane 1,1-dioxide |
| SMILES | CCN1CCC(N2CCNCCS2(=O)=O)C1 |
| InChI | InChI=1S/C10H21N3O2S/c1-2-12-6-3-10(9-12)13-7-4-11-5-8-16(13,14)15/h10-11H,2-9H2,1H3 |
| InChIKey | SUPKGQGSPFSFOG-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |