C8H17N3O2S — CID 115101005
2-pyrrolidin-2-yl-1,2,5-thiadiazepane 1,1-dioxide (PubChem CID 115101005) has the molecular formula C8H17N3O2S and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-1,2,5-thiadiazepane 1,1-dioxide.
| Compound Name | 2-pyrrolidin-2-yl-1,2,5-thiadiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 115101005 |
| Molecular Formula | C8H17N3O2S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-pyrrolidin-2-yl-1,2,5-thiadiazepane 1,1-dioxide |
| SMILES | O=S1(=O)CCNCCN1C1CCCN1 |
| InChI | InChI=1S/C8H17N3O2S/c12-14(13)7-5-9-4-6-11(14)8-2-1-3-10-8/h8-10H,1-7H2 |
| InChIKey | BRPPAZOEBAOMKG-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |