C8H16N2O2S — CID 83819748
2-pyrrolidin-3-ylthiazinane 1,1-dioxide (PubChem CID 83819748) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is 2-pyrrolidin-3-ylthiazinane 1,1-dioxide.
| Compound Name | 2-pyrrolidin-3-ylthiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 83819748 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-pyrrolidin-3-ylthiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCN1C1CCNC1 |
| InChI | InChI=1S/C8H16N2O2S/c11-13(12)6-2-1-5-10(13)8-3-4-9-7-8/h8-9H,1-7H2 |
| InChIKey | LLQUPVQRRJCYBO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |