C13H18N2O2S — CID 116814629
2-(1,2,3,4-tetrahydroquinolin-3-yl)thiazinane 1,1-dioxide (PubChem CID 116814629) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydroquinolin-3-yl)thiazinane 1,1-dioxide.
| Compound Name | 2-(1,2,3,4-tetrahydroquinolin-3-yl)thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 116814629 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(1,2,3,4-tetrahydroquinolin-3-yl)thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCN1C1CNc2ccccc2C1 |
| InChI | InChI=1S/C13H18N2O2S/c16-18(17)8-4-3-7-15(18)12-9-11-5-1-2-6-13(11)14-10-12/h1-2,5-6,12,14H,3-4,7-10H2 |
| InChIKey | INIXXKVIRIRKGW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |