C15H22N2 — CID 118462093
3-(1-methylpiperidin-4-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 118462093) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 3-(1-methylpiperidin-4-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-(1-methylpiperidin-4-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 118462093 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3-(1-methylpiperidin-4-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CN1CCC(C2CNc3ccccc3C2)CC1 |
| InChI | InChI=1S/C15H22N2/c1-17-8-6-12(7-9-17)14-10-13-4-2-3-5-15(13)16-11-14/h2-5,12,14,16H,6-11H2,1H3 |
| InChIKey | VFKUZJWHWVZDEN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |