C11H22N2O2S2 — CID 115101155
7,7-dimethyl-2-(thian-2-yl)-1,2,5-thiadiazepane 1,1-dioxide (PubChem CID 115101155) has the molecular formula C11H22N2O2S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 7,7-dimethyl-2-(thian-2-yl)-1,2,5-thiadiazepane 1,1-dioxide.
| Compound Name | 7,7-dimethyl-2-(thian-2-yl)-1,2,5-thiadiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 115101155 |
| Molecular Formula | C11H22N2O2S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 7,7-dimethyl-2-(thian-2-yl)-1,2,5-thiadiazepane 1,1-dioxide |
| SMILES | CC1(C)CNCCN(C2CCCCS2)S1(=O)=O |
| InChI | InChI=1S/C11H22N2O2S2/c1-11(2)9-12-6-7-13(17(11,14)15)10-5-3-4-8-16-10/h10,12H,3-9H2,1-2H3 |
| InChIKey | FPHLUCVAZVJUDX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |