C23H22F3N3O2 — CID 11510223
1-(4-tert-butylphenyl)-3-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]urea (PubChem CID 11510223) has the molecular formula C23H22F3N3O2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 11510223 |
| Molecular Formula | C23H22F3N3O2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[2-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)Nc2cccnc2Oc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H22F3N3O2/c1-22(2,3)15-9-11-17(12-10-15)28-21(30)29-19-8-5-13-27-20(19)31-18-7-4-6-16(14-18)23(24,25)26/h4-14H,1-3H3,(H2,28,29,30) |
| InChIKey | JJWZHCRWCMWVGL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |