C20H13F6N3O2S — CID 2800861
1-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 2800861) has the molecular formula C20H13F6N3O2S and a molecular weight of 473.40 g/mol. Its IUPAC name is 1-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 2800861 |
| Molecular Formula | C20H13F6N3O2S |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 1-[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(SC(F)(F)F)cc1)Nc1ccc(Oc2cccc(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C20H13F6N3O2S/c21-19(22,23)12-2-1-3-15(10-12)31-17-9-6-14(11-27-17)29-18(30)28-13-4-7-16(8-5-13)32-20(24,25)26/h1-11H,(H2,28,29,30) |
| InChIKey | MFULJCMNLNZEFB-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |