C10H18N2O3 — CID 115102279
3-(3,4-dimethyl-2-oxo-1,4-diazepan-1-yl)propanoic acid (PubChem CID 115102279) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 3-(3,4-dimethyl-2-oxo-1,4-diazepan-1-yl)propanoic acid.
| Compound Name | 3-(3,4-dimethyl-2-oxo-1,4-diazepan-1-yl)propanoic acid |
|---|---|
| PubChem CID | 115102279 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 3-(3,4-dimethyl-2-oxo-1,4-diazepan-1-yl)propanoic acid |
| SMILES | CC1C(=O)N(CCC(=O)O)CCCN1C |
| InChI | InChI=1S/C10H18N2O3/c1-8-10(15)12(7-4-9(13)14)6-3-5-11(8)2/h8H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | RDTHYRVUFBZMNG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |