C16H25N3 — CID 115105433
6-[3-(4-methylpiperazin-1-yl)propyl]-2,3-dihydro-1H-indole (PubChem CID 115105433) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 6-[3-(4-methylpiperazin-1-yl)propyl]-2,3-dihydro-1H-indole.
| Compound Name | 6-[3-(4-methylpiperazin-1-yl)propyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115105433 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 6-[3-(4-methylpiperazin-1-yl)propyl]-2,3-dihydro-1H-indole |
| SMILES | CN1CCN(CCCc2ccc3c(c2)NCC3)CC1 |
| InChI | InChI=1S/C16H25N3/c1-18-9-11-19(12-10-18)8-2-3-14-4-5-15-6-7-17-16(15)13-14/h4-5,13,17H,2-3,6-12H2,1H3 |
| InChIKey | TWYJPIUWAMPMED-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |