C11H16N2 — CID 115105426
3-(2,3-dihydro-1H-indol-6-yl)propan-1-amine (PubChem CID 115105426) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-6-yl)propan-1-amine.
| Compound Name | 3-(2,3-dihydro-1H-indol-6-yl)propan-1-amine |
|---|---|
| PubChem CID | 115105426 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-6-yl)propan-1-amine |
| SMILES | NCCCc1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C11H16N2/c12-6-1-2-9-3-4-10-5-7-13-11(10)8-9/h3-4,8,13H,1-2,5-7,12H2 |
| InChIKey | GVGJSLOONVFTJH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |