C24H27F3N4O — CID 11510565
[4-(2-pentyl-3H-benzimidazol-5-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 11510565) has the molecular formula C24H27F3N4O and a molecular weight of 444.50 g/mol. Its IUPAC name is [4-(2-pentyl-3H-benzimidazol-5-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(2-pentyl-3H-benzimidazol-5-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 11510565 |
| Molecular Formula | C24H27F3N4O |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | [4-(2-pentyl-3H-benzimidazol-5-yl)piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | CCCCCc1nc2ccc(N3CCN(C(=O)c4ccccc4C(F)(F)F)CC3)cc2[nH]1 |
| InChI | InChI=1S/C24H27F3N4O/c1-2-3-4-9-22-28-20-11-10-17(16-21(20)29-22)30-12-14-31(15-13-30)23(32)18-7-5-6-8-19(18)24(25,26)27/h5-8,10-11,16H,2-4,9,12-15H2,1H3,(H,28,29) |
| InChIKey | UWEIAULOMZAVFL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|