C15H18N4O2 — CID 9925900
2-(1-acetylpiperidin-4-yl)-1H-1,3-benzodiazole-4-carboxamide (PubChem CID 9925900) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-(1-acetylpiperidin-4-yl)-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-(1-acetylpiperidin-4-yl)-1H-1,3-benzodiazole-4-carboxamide |
|---|---|
| PubChem CID | 9925900 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-(1-acetylpiperidin-4-yl)-1H-benzimidazole-4-carboxamide |
| SMILES | CC(=O)N1CCC(CC1)C2=NC3=C(C=CC=C3N2)C(=O)N |
| InChI | InChI=1S/C15H18N4O2/c1-9(20)19-7-5-10(6-8-19)15-17-12-4-2-3-11(14(16)21)13(12)18-15/h2-4,10H,5-8H2,1H3,(H2,16,21)(H,17,18) |
| InChIKey | IACRACWAOCNMPX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | 420 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |