C15H19NO2 — CID 115106001
2-[1-(cyclopropylmethyl)-2,3-dihydroindol-5-yl]propanoic acid (PubChem CID 115106001) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-[1-(cyclopropylmethyl)-2,3-dihydroindol-5-yl]propanoic acid.
| Compound Name | 2-[1-(cyclopropylmethyl)-2,3-dihydroindol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 115106001 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-[1-(cyclopropylmethyl)-2,3-dihydroindol-5-yl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc2c(c1)CCN2CC1CC1 |
| InChI | InChI=1S/C15H19NO2/c1-10(15(17)18)12-4-5-14-13(8-12)6-7-16(14)9-11-2-3-11/h4-5,8,10-11H,2-3,6-7,9H2,1H3,(H,17,18) |
| InChIKey | VIZZVIKBISLKJZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |