C17H23NO — CID 115106375
1-[1-(cyclopentylmethyl)-2,3-dihydroindol-3-yl]propan-2-one (PubChem CID 115106375) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-[1-(cyclopentylmethyl)-2,3-dihydroindol-3-yl]propan-2-one.
| Compound Name | 1-[1-(cyclopentylmethyl)-2,3-dihydroindol-3-yl]propan-2-one |
|---|---|
| PubChem CID | 115106375 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1-[1-(cyclopentylmethyl)-2,3-dihydroindol-3-yl]propan-2-one |
| SMILES | CC(=O)CC1CN(CC2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C17H23NO/c1-13(19)10-15-12-18(11-14-6-2-3-7-14)17-9-5-4-8-16(15)17/h4-5,8-9,14-15H,2-3,6-7,10-12H2,1H3 |
| InChIKey | LGLFZOBENIOOHU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |