C15H15NO2S — CID 80578332
2-[1-(thiophen-2-ylmethyl)-2,3-dihydroindol-3-yl]acetic acid (PubChem CID 80578332) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-[1-(thiophen-2-ylmethyl)-2,3-dihydroindol-3-yl]acetic acid.
| Compound Name | 2-[1-(thiophen-2-ylmethyl)-2,3-dihydroindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 80578332 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[1-(thiophen-2-ylmethyl)-2,3-dihydroindol-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(Cc2cccs2)c2ccccc21 |
| InChI | InChI=1S/C15H15NO2S/c17-15(18)8-11-9-16(10-12-4-3-7-19-12)14-6-2-1-5-13(11)14/h1-7,11H,8-10H2,(H,17,18) |
| InChIKey | DAIPLMLLDMDOIS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |