C12H14N2O2 — CID 115107456
8-hydroxy-2,3,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-1-one (PubChem CID 115107456) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 8-hydroxy-2,3,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-1-one.
| Compound Name | 8-hydroxy-2,3,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-1-one |
|---|---|
| PubChem CID | 115107456 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 8-hydroxy-2,3,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-1-one |
| SMILES | O=C1CNCC2CCc3cc(O)ccc3N12 |
| InChI | InChI=1S/C12H14N2O2/c15-10-3-4-11-8(5-10)1-2-9-6-13-7-12(16)14(9)11/h3-5,9,13,15H,1-2,6-7H2 |
| InChIKey | QOONGLRBVBLSQH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |