C12H7FN2O2S — CID 115109826
5-(7-fluoro-1-benzothiophen-2-yl)-1H-pyrazole-3-carboxylic acid (PubChem CID 115109826) has the molecular formula C12H7FN2O2S and a molecular weight of 262.26 g/mol. Its IUPAC name is 5-(7-fluoro-1-benzothiophen-2-yl)-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-(7-fluoro-1-benzothiophen-2-yl)-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 115109826 |
| Molecular Formula | C12H7FN2O2S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 5-(7-fluoro-1-benzothiophen-2-yl)-1H-pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc3cccc(F)c3s2)[nH]n1 |
| InChI | InChI=1S/C12H7FN2O2S/c13-7-3-1-2-6-4-10(18-11(6)7)8-5-9(12(16)17)15-14-8/h1-5H,(H,14,15)(H,16,17) |
| InChIKey | XRZKBOIPGGUTIZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |