C13H7F3N2O3 — CID 115109859
5-[6-(trifluoromethyl)-1-benzofuran-2-yl]-1H-pyrazole-3-carboxylic acid (PubChem CID 115109859) has the molecular formula C13H7F3N2O3 and a molecular weight of 296.20 g/mol. Its IUPAC name is 5-[6-(trifluoromethyl)-1-benzofuran-2-yl]-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-[6-(trifluoromethyl)-1-benzofuran-2-yl]-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 115109859 |
| Molecular Formula | C13H7F3N2O3 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 5-[6-(trifluoromethyl)-1-benzofuran-2-yl]-1H-pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc3ccc(C(F)(F)F)cc3o2)[nH]n1 |
| InChI | InChI=1S/C13H7F3N2O3/c14-13(15,16)7-2-1-6-3-11(21-10(6)4-7)8-5-9(12(19)20)18-17-8/h1-5H,(H,17,18)(H,19,20) |
| InChIKey | NATJLACZTYJFAS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |